C12H11F3N2 — CID 63232484
3-ethyl-5,6,7-trifluoro-N-methylquinolin-2-amine (PubChem CID 63232484) has the molecular formula C12H11F3N2 and a molecular weight of 240.23 g/mol. Its IUPAC name is 3-ethyl-5,6,7-trifluoro-N-methylquinolin-2-amine.
| Compound Name | 3-ethyl-5,6,7-trifluoro-N-methylquinolin-2-amine |
|---|---|
| PubChem CID | 63232484 |
| Molecular Formula | C12H11F3N2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-ethyl-5,6,7-trifluoro-N-methylquinolin-2-amine |
| SMILES | CCc1cc2c(F)c(F)c(F)cc2nc1NC |
| InChI | InChI=1S/C12H11F3N2/c1-3-6-4-7-9(17-12(6)16-2)5-8(13)11(15)10(7)14/h4-5H,3H2,1-2H3,(H,16,17) |
| InChIKey | OVUXWHXYQRBWOU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|