C13H16N2O — CID 63232322
8-(methoxymethyl)-N,3-dimethylquinolin-2-amine (PubChem CID 63232322) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 8-(methoxymethyl)-N,3-dimethylquinolin-2-amine.
| Compound Name | 8-(methoxymethyl)-N,3-dimethylquinolin-2-amine |
|---|---|
| PubChem CID | 63232322 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 8-(methoxymethyl)-N,3-dimethylquinolin-2-amine |
| SMILES | CNc1nc2c(COC)cccc2cc1C |
| InChI | InChI=1S/C13H16N2O/c1-9-7-10-5-4-6-11(8-16-3)12(10)15-13(9)14-2/h4-7H,8H2,1-3H3,(H,14,15) |
| InChIKey | QCLHDKAHWOESMF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |