C19H22N2 — CID 63526295
N,3-dipropylbenzo[h]quinolin-2-amine (PubChem CID 63526295) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N,3-dipropylbenzo[h]quinolin-2-amine.
| Compound Name | N,3-dipropylbenzo[h]quinolin-2-amine |
|---|---|
| PubChem CID | 63526295 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N,3-dipropylbenzo[h]quinolin-2-amine |
| SMILES | CCCNc1nc2c(ccc3ccccc32)cc1CCC |
| InChI | InChI=1S/C19H22N2/c1-3-7-16-13-15-11-10-14-8-5-6-9-17(14)18(15)21-19(16)20-12-4-2/h5-6,8-11,13H,3-4,7,12H2,1-2H3,(H,20,21) |
| InChIKey | FIWXUICUEXSGFE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|