C16H22N2O — CID 63523658
6-methoxy-N,3-dipropylquinolin-2-amine (PubChem CID 63523658) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 6-methoxy-N,3-dipropylquinolin-2-amine.
| Compound Name | 6-methoxy-N,3-dipropylquinolin-2-amine |
|---|---|
| PubChem CID | 63523658 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 6-methoxy-N,3-dipropylquinolin-2-amine |
| SMILES | CCCNc1nc2ccc(OC)cc2cc1CCC |
| InChI | InChI=1S/C16H22N2O/c1-4-6-12-10-13-11-14(19-3)7-8-15(13)18-16(12)17-9-5-2/h7-8,10-11H,4-6,9H2,1-3H3,(H,17,18) |
| InChIKey | BJFWQZAFEGGAIO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |