About 6-propan-2-yl-N,3-dipropylquinolin-2-amine
6-propan-2-yl-N,3-dipropylquinolin-2-amine (PubChem CID 63525770) has the molecular formula C18H26N2
and a molecular weight of 270.42 g/mol. Its IUPAC name is 6-propan-2-yl-N,3-dipropylquinolin-2-amine.
Molecular Properties
| Compound Name | 6-propan-2-yl-N,3-dipropylquinolin-2-amine |
| PubChem CID | 63525770 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 6-propan-2-yl-N,3-dipropylquinolin-2-amine |
| SMILES | CCCNc1nc2ccc(C(C)C)cc2cc1CCC |
| InChI | InChI=1S/C18H26N2/c1-5-7-15-12-16-11-14(13(3)4)8-9-17(16)20-18(15)19-10-6-2/h8-9,11-13H,5-7,10H2,1-4H3,(H,19,20) |
| InChIKey | SZRIMUHIBSPIMR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-propan-2-yl-N,3-dipropylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-N,3-dipropylquinolin-2-amine?
The IUPAC name of 6-propan-2-yl-N,3-dipropylquinolin-2-amine (CID 63525770) is 6-propan-2-yl-N,3-dipropylquinolin-2-amine.
What is the SMILES notation for 6-propan-2-yl-N,3-dipropylquinolin-2-amine?
The canonical SMILES for 6-propan-2-yl-N,3-dipropylquinolin-2-amine is CCCNc1nc2ccc(C(C)C)cc2cc1CCC.
What is the InChIKey of 6-propan-2-yl-N,3-dipropylquinolin-2-amine?
The InChIKey is SZRIMUHIBSPIMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2/c1-5-7-15-12-16-11-14(13(3)4)8-9-17(16)20-18(15)19-10-6-2/h8-9,11-13H,5-7,10H2,1-4H3,(H,19,20).
What are the key properties of 6-propan-2-yl-N,3-dipropylquinolin-2-amine?
6-propan-2-yl-N,3-dipropylquinolin-2-amine has a molecular weight of 270.42 g/mol, XLogP of 5.13, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-N,3-dipropylquinolin-2-amine is sourced from PubChem (CID 63525770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).