About 1-heptylphenazine;hydrochloride
1-heptylphenazine;hydrochloride (PubChem CID 175352325) has the molecular formula C19H23ClN2
and a molecular weight of 314.86 g/mol. Its IUPAC name is 1-heptylphenazine;hydrochloride.
Molecular Properties
| Compound Name | 1-heptylphenazine;hydrochloride |
| PubChem CID | 175352325 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-heptylphenazine;hydrochloride |
| SMILES | CCCCCCCc1cccc2nc3ccccc3nc12.Cl |
| InChI | InChI=1S/C19H22N2.ClH/c1-2-3-4-5-6-10-15-11-9-14-18-19(15)21-17-13-8-7-12-16(17)20-18;/h7-9,11-14H,2-6,10H2,1H3;1H |
| InChIKey | BMOFKNWLVGVSRG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-heptylphenazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptylphenazine;hydrochloride?
The IUPAC name of 1-heptylphenazine;hydrochloride (CID 175352325) is 1-heptylphenazine;hydrochloride.
What is the SMILES notation for 1-heptylphenazine;hydrochloride?
The canonical SMILES for 1-heptylphenazine;hydrochloride is CCCCCCCc1cccc2nc3ccccc3nc12.Cl.
What is the InChIKey of 1-heptylphenazine;hydrochloride?
The InChIKey is BMOFKNWLVGVSRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2.ClH/c1-2-3-4-5-6-10-15-11-9-14-18-19(15)21-17-13-8-7-12-16(17)20-18;/h7-9,11-14H,2-6,10H2,1H3;1H.
What are the key properties of 1-heptylphenazine;hydrochloride?
1-heptylphenazine;hydrochloride has a molecular weight of 314.86 g/mol, XLogP of 5.72, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptylphenazine;hydrochloride is sourced from PubChem (CID 175352325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).