About 4-hexyl-1,3-benzoxazole
4-hexyl-1,3-benzoxazole (PubChem CID 91584935) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is 4-hexyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 4-hexyl-1,3-benzoxazole |
| PubChem CID | 91584935 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-hexyl-1,3-benzoxazole |
| SMILES | CCCCCCc1cccc2ocnc12 |
| InChI | InChI=1S/C13H17NO/c1-2-3-4-5-7-11-8-6-9-12-13(11)14-10-15-12/h6,8-10H,2-5,7H2,1H3 |
| InChIKey | OMPIWANLKDKOTL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexyl-1,3-benzoxazole?
The IUPAC name of 4-hexyl-1,3-benzoxazole (CID 91584935) is 4-hexyl-1,3-benzoxazole.
What is the SMILES notation for 4-hexyl-1,3-benzoxazole?
The canonical SMILES for 4-hexyl-1,3-benzoxazole is CCCCCCc1cccc2ocnc12.
What is the InChIKey of 4-hexyl-1,3-benzoxazole?
The InChIKey is OMPIWANLKDKOTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-2-3-4-5-7-11-8-6-9-12-13(11)14-10-15-12/h6,8-10H,2-5,7H2,1H3.
What are the key properties of 4-hexyl-1,3-benzoxazole?
4-hexyl-1,3-benzoxazole has a molecular weight of 203.29 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexyl-1,3-benzoxazole is sourced from PubChem (CID 91584935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).