About acridin-4-ylboronic acid
acridin-4-ylboronic acid (PubChem CID 158530162) has the molecular formula C13H10BNO2
and a molecular weight of 223.04 g/mol. Its IUPAC name is acridin-4-ylboronic acid.
Molecular Properties
| Compound Name | acridin-4-ylboronic acid |
| PubChem CID | 158530162 |
| Molecular Formula | C13H10BNO2 |
| Molecular Weight | 223.04 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | acridin-4-ylboronic acid |
| SMILES | OB(O)c1cccc2cc3ccccc3nc12 |
| InChI | InChI=1S/C13H10BNO2/c16-14(17)11-6-3-5-10-8-9-4-1-2-7-12(9)15-13(10)11/h1-8,16-17H |
| InChIKey | HNGPPPQOGNFLJS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.04 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridin-4-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridin-4-ylboronic acid?
The IUPAC name of acridin-4-ylboronic acid (CID 158530162) is acridin-4-ylboronic acid.
What is the SMILES notation for acridin-4-ylboronic acid?
The canonical SMILES for acridin-4-ylboronic acid is OB(O)c1cccc2cc3ccccc3nc12.
What is the InChIKey of acridin-4-ylboronic acid?
The InChIKey is HNGPPPQOGNFLJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BNO2/c16-14(17)11-6-3-5-10-8-9-4-1-2-7-12(9)15-13(10)11/h1-8,16-17H.
What are the key properties of acridin-4-ylboronic acid?
acridin-4-ylboronic acid has a molecular weight of 223.04 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acridin-4-ylboronic acid is sourced from PubChem (CID 158530162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).