About acridine-4-carboxamide
acridine-4-carboxamide (PubChem CID 3025721) has the molecular formula C14H10N2O
and a molecular weight of 222.25 g/mol. Its IUPAC name is acridine-4-carboxamide.
Molecular Properties
| Compound Name | acridine-4-carboxamide |
| PubChem CID | 3025721 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | acridine-4-carboxamide |
| SMILES | NC(=O)c1cccc2cc3ccccc3nc12 |
| InChI | InChI=1S/C14H10N2O/c15-14(17)11-6-3-5-10-8-9-4-1-2-7-12(9)16-13(10)11/h1-8H,(H2,15,17) |
| InChIKey | KCBDLLNCTLQLPL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine-4-carboxamide?
The IUPAC name of acridine-4-carboxamide (CID 3025721) is acridine-4-carboxamide.
What is the SMILES notation for acridine-4-carboxamide?
The canonical SMILES for acridine-4-carboxamide is NC(=O)c1cccc2cc3ccccc3nc12.
What is the InChIKey of acridine-4-carboxamide?
The InChIKey is KCBDLLNCTLQLPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O/c15-14(17)11-6-3-5-10-8-9-4-1-2-7-12(9)16-13(10)11/h1-8H,(H2,15,17).
What are the key properties of acridine-4-carboxamide?
acridine-4-carboxamide has a molecular weight of 222.25 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acridine-4-carboxamide is sourced from PubChem (CID 3025721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).