C15H11N3O2 — CID 154155519
acridine-1,2-dicarboxamide (PubChem CID 154155519) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is acridine-1,2-dicarboxamide.
| Compound Name | acridine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 154155519 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | acridine-1,2-dicarboxamide |
| SMILES | NC(=O)c1ccc2nc3ccccc3cc2c1C(N)=O |
| InChI | InChI=1S/C15H11N3O2/c16-14(19)9-5-6-12-10(13(9)15(17)20)7-8-3-1-2-4-11(8)18-12/h1-7H,(H2,16,19)(H2,17,20) |
| InChIKey | UAQYFNAOQLUHOQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|