About naphthalene-1,2-dicarboxamide;tetrazine
naphthalene-1,2-dicarboxamide;tetrazine (PubChem CID 175558272) has the molecular formula C14H12N6O2
and a molecular weight of 296.29 g/mol. Its IUPAC name is naphthalene-1,2-dicarboxamide;tetrazine.
Molecular Properties
| Compound Name | naphthalene-1,2-dicarboxamide;tetrazine |
| PubChem CID | 175558272 |
| Molecular Formula | C14H12N6O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | naphthalene-1,2-dicarboxamide;tetrazine |
| SMILES | NC(=O)c1ccc2ccccc2c1C(N)=O.c1cnnnn1 |
| InChI | InChI=1S/C12H10N2O2.C2H2N4/c13-11(15)9-6-5-7-3-1-2-4-8(7)10(9)12(14)16;1-2-4-6-5-3-1/h1-6H,(H2,13,15)(H2,14,16);1-2H |
| InChIKey | RDJZHSMVIQYXQO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze naphthalene-1,2-dicarboxamide;tetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,2-dicarboxamide;tetrazine?
The IUPAC name of naphthalene-1,2-dicarboxamide;tetrazine (CID 175558272) is naphthalene-1,2-dicarboxamide;tetrazine.
What is the SMILES notation for naphthalene-1,2-dicarboxamide;tetrazine?
The canonical SMILES for naphthalene-1,2-dicarboxamide;tetrazine is NC(=O)c1ccc2ccccc2c1C(N)=O.c1cnnnn1.
What is the InChIKey of naphthalene-1,2-dicarboxamide;tetrazine?
The InChIKey is RDJZHSMVIQYXQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2.C2H2N4/c13-11(15)9-6-5-7-3-1-2-4-8(7)10(9)12(14)16;1-2-4-6-5-3-1/h1-6H,(H2,13,15)(H2,14,16);1-2H.
What are the key properties of naphthalene-1,2-dicarboxamide;tetrazine?
naphthalene-1,2-dicarboxamide;tetrazine has a molecular weight of 296.29 g/mol, XLogP of 0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,2-dicarboxamide;tetrazine is sourced from PubChem (CID 175558272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).