C23H20N4O3 — CID 140548769
10,11-dioxa-8,9,27-triazatricyclo[17.8.0.021,26]heptacosa-1,3,5,7,12,14,16,18,20,22,24,26-dodecaene-25-carboxamide (PubChem CID 140548769) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 10,11-dioxa-8,9,27-triazatricyclo[17.8.0.021,26]heptacosa-1,3,5,7,12,14,16,18,20,22,24,26-dodecaene-25-carboxamide.
| Compound Name | 10,11-dioxa-8,9,27-triazatricyclo[17.8.0.021,26]heptacosa-1,3,5,7,12,14,16,18,20,22,24,26-dodecaene-25-carboxamide |
|---|---|
| PubChem CID | 140548769 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 10,11-dioxa-8,9,27-triazatricyclo[17.8.0.021,26]heptacosa-1,3,5,7,12,14,16,18,20,22,24,26-dodecaene-25-carboxamide |
| SMILES | NC(=O)c1cccc2cc3cccccccoo[nH]nccccccc3nc12 |
| InChI | InChI=1S/C23H20N4O3/c24-23(28)20-13-10-12-19-17-18-11-6-2-1-5-9-16-29-30-27-25-15-8-4-3-7-14-21(18)26-22(19)20/h1-17,27H,(H2,24,28)/b5-1-,6-2-,7-3-,8-4-,16-9-,18-11-,21-14+,25-15- |
| InChIKey | YTBIOXOLBRFIOW-JLSDYIFBSA-N |
| XLogP | 4.89 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |