About phenazine-1-carboxamide
phenazine-1-carboxamide (PubChem CID 141278918) has the molecular formula C26H18N6O2
and a molecular weight of 446.47 g/mol. Its IUPAC name is phenazine-1-carboxamide.
Molecular Properties
| Compound Name | phenazine-1-carboxamide |
| PubChem CID | 141278918 |
| Molecular Formula | C26H18N6O2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | phenazine-1-carboxamide |
| SMILES | NC(=O)c1cccc2nc3ccccc3nc12.NC(=O)c1cccc2nc3ccccc3nc12 |
| InChI | InChI=1S/2C13H9N3O/c2*14-13(17)8-4-3-7-11-12(8)16-10-6-2-1-5-9(10)15-11/h2*1-7H,(H2,14,17) |
| InChIKey | MDOCUZYOMSFVKX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenazine-1-carboxamide?
The IUPAC name of phenazine-1-carboxamide (CID 141278918) is phenazine-1-carboxamide.
What is the SMILES notation for phenazine-1-carboxamide?
The canonical SMILES for phenazine-1-carboxamide is NC(=O)c1cccc2nc3ccccc3nc12.NC(=O)c1cccc2nc3ccccc3nc12.
What is the InChIKey of phenazine-1-carboxamide?
The InChIKey is MDOCUZYOMSFVKX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H9N3O/c2*14-13(17)8-4-3-7-11-12(8)16-10-6-2-1-5-9(10)15-11/h2*1-7H,(H2,14,17).
What are the key properties of phenazine-1-carboxamide?
phenazine-1-carboxamide has a molecular weight of 446.47 g/mol, XLogP of 3.76, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenazine-1-carboxamide is sourced from PubChem (CID 141278918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).