C8H6N2O2 — CID 68873246
2,1-benzoxazole-7-carboxamide (PubChem CID 68873246) has the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. Its IUPAC name is 2,1-benzoxazole-7-carboxamide.
| Compound Name | 2,1-benzoxazole-7-carboxamide |
|---|---|
| PubChem CID | 68873246 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 2,1-benzoxazole-7-carboxamide |
| SMILES | NC(=O)c1cccc2conc12 |
| InChI | InChI=1S/C8H6N2O2/c9-8(11)6-3-1-2-5-4-12-10-7(5)6/h1-4H,(H2,9,11) |
| InChIKey | MXKAKVCTGGYRIK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |