C10H6Cl2N2O2 — CID 870179
3-(2,3-dichlorophenyl)-1,2-oxazole-4-carboxamide (PubChem CID 870179) has the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.08 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2,3-dichlorophenyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 870179 |
| Molecular Formula | C10H6Cl2N2O2 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1,2-oxazole-4-carboxamide |
| SMILES | NC(=O)c1conc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H6Cl2N2O2/c11-7-3-1-2-5(8(7)12)9-6(10(13)15)4-16-14-9/h1-4H,(H2,13,15) |
| InChIKey | LUNAFUAKNDCSRY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |