About 3-methylacridin-4-ol
3-methylacridin-4-ol (PubChem CID 89346727) has the molecular formula C14H11NO
and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-methylacridin-4-ol.
Molecular Properties
| Compound Name | 3-methylacridin-4-ol |
| PubChem CID | 89346727 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 3-methylacridin-4-ol |
| SMILES | Cc1ccc2cc3ccccc3nc2c1O |
| InChI | InChI=1S/C14H11NO/c1-9-6-7-11-8-10-4-2-3-5-12(10)15-13(11)14(9)16/h2-8,16H,1H3 |
| InChIKey | HYWIEEDCWLNGHP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylacridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylacridin-4-ol?
The IUPAC name of 3-methylacridin-4-ol (CID 89346727) is 3-methylacridin-4-ol.
What is the SMILES notation for 3-methylacridin-4-ol?
The canonical SMILES for 3-methylacridin-4-ol is Cc1ccc2cc3ccccc3nc2c1O.
What is the InChIKey of 3-methylacridin-4-ol?
The InChIKey is HYWIEEDCWLNGHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO/c1-9-6-7-11-8-10-4-2-3-5-12(10)15-13(11)14(9)16/h2-8,16H,1H3.
What are the key properties of 3-methylacridin-4-ol?
3-methylacridin-4-ol has a molecular weight of 209.25 g/mol, XLogP of 3.40, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylacridin-4-ol is sourced from PubChem (CID 89346727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).