About 4-methylbenzo[b][1,6]naphthyridine
4-methylbenzo[b][1,6]naphthyridine (PubChem CID 144676863) has the molecular formula C13H10N2
and a molecular weight of 194.24 g/mol. Its IUPAC name is 4-methylbenzo[b][1,6]naphthyridine.
Molecular Properties
| Compound Name | 4-methylbenzo[b][1,6]naphthyridine |
| PubChem CID | 144676863 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 4-methylbenzo[b][1,6]naphthyridine |
| SMILES | Cc1cncc2cc3ccccc3nc12 |
| InChI | InChI=1S/C13H10N2/c1-9-7-14-8-11-6-10-4-2-3-5-12(10)15-13(9)11/h2-8H,1H3 |
| InChIKey | LLUMWTUIHFLLFH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzo[b][1,6]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzo[b][1,6]naphthyridine?
The IUPAC name of 4-methylbenzo[b][1,6]naphthyridine (CID 144676863) is 4-methylbenzo[b][1,6]naphthyridine.
What is the SMILES notation for 4-methylbenzo[b][1,6]naphthyridine?
The canonical SMILES for 4-methylbenzo[b][1,6]naphthyridine is Cc1cncc2cc3ccccc3nc12.
What is the InChIKey of 4-methylbenzo[b][1,6]naphthyridine?
The InChIKey is LLUMWTUIHFLLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2/c1-9-7-14-8-11-6-10-4-2-3-5-12(10)15-13(9)11/h2-8H,1H3.
What are the key properties of 4-methylbenzo[b][1,6]naphthyridine?
4-methylbenzo[b][1,6]naphthyridine has a molecular weight of 194.24 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzo[b][1,6]naphthyridine is sourced from PubChem (CID 144676863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).