C18H24N2O — CID 145233565
2,4-dimethylphenazin-1-ol;ethane (PubChem CID 145233565) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2,4-dimethylphenazin-1-ol;ethane.
| Compound Name | 2,4-dimethylphenazin-1-ol;ethane |
|---|---|
| PubChem CID | 145233565 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2,4-dimethylphenazin-1-ol;ethane |
| SMILES | CC.CC.Cc1cc(C)c2nc3ccccc3nc2c1O |
| InChI | InChI=1S/C14H12N2O.2C2H6/c1-8-7-9(2)14(17)13-12(8)15-10-5-3-4-6-11(10)16-13;2*1-2/h3-7,17H,1-2H3;2*1-2H3 |
| InChIKey | ISTACTKENDACCB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|