About 3-bromo-4-hexylquinoline
3-bromo-4-hexylquinoline (PubChem CID 134275854) has the molecular formula C15H18BrN
and a molecular weight of 292.22 g/mol. Its IUPAC name is 3-bromo-4-hexylquinoline.
Molecular Properties
| Compound Name | 3-bromo-4-hexylquinoline |
| PubChem CID | 134275854 |
| Molecular Formula | C15H18BrN |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-bromo-4-hexylquinoline |
| SMILES | CCCCCCc1c(Br)cnc2ccccc12 |
| InChI | InChI=1S/C15H18BrN/c1-2-3-4-5-8-12-13-9-6-7-10-15(13)17-11-14(12)16/h6-7,9-11H,2-5,8H2,1H3 |
| InChIKey | ZDBOMRAYUNZORL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-hexylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-hexylquinoline?
The IUPAC name of 3-bromo-4-hexylquinoline (CID 134275854) is 3-bromo-4-hexylquinoline.
What is the SMILES notation for 3-bromo-4-hexylquinoline?
The canonical SMILES for 3-bromo-4-hexylquinoline is CCCCCCc1c(Br)cnc2ccccc12.
What is the InChIKey of 3-bromo-4-hexylquinoline?
The InChIKey is ZDBOMRAYUNZORL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrN/c1-2-3-4-5-8-12-13-9-6-7-10-15(13)17-11-14(12)16/h6-7,9-11H,2-5,8H2,1H3.
What are the key properties of 3-bromo-4-hexylquinoline?
3-bromo-4-hexylquinoline has a molecular weight of 292.22 g/mol, XLogP of 5.12, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-hexylquinoline is sourced from PubChem (CID 134275854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).