C19H31Cl2N3 — CID 126622258
4-(5-aminopentyl)-3-pentylquinolin-2-amine;dihydrochloride (PubChem CID 126622258) has the molecular formula C19H31Cl2N3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 4-(5-aminopentyl)-3-pentylquinolin-2-amine;dihydrochloride.
| Compound Name | 4-(5-aminopentyl)-3-pentylquinolin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 126622258 |
| Molecular Formula | C19H31Cl2N3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 4-(5-aminopentyl)-3-pentylquinolin-2-amine;dihydrochloride |
| SMILES | CCCCCc1c(N)nc2ccccc2c1CCCCCN.Cl.Cl |
| InChI | InChI=1S/C19H29N3.2ClH/c1-2-3-5-12-17-15(10-6-4-9-14-20)16-11-7-8-13-18(16)22-19(17)21;;/h7-8,11,13H,2-6,9-10,12,14,20H2,1H3,(H2,21,22);2*1H |
| InChIKey | IYLFRWNOWBBWGT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|