C15H14Cl2N3O3+ — CID 18552112
N-(4-acetamido-3,5-dichlorophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide (PubChem CID 18552112) has the molecular formula C15H14Cl2N3O3+ and a molecular weight of 355.20 g/mol. Its IUPAC name is N-(4-acetamido-3,5-dichlorophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide.
| Compound Name | N-(4-acetamido-3,5-dichlorophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 18552112 |
| Molecular Formula | C15H14Cl2N3O3+ |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | N-(4-acetamido-3,5-dichlorophenyl)-N-hydroxy-2-pyridin-1-ium-1-ylacetamide |
| SMILES | CC(=O)Nc1c(Cl)cc(N(O)C(=O)C[n+]2ccccc2)cc1Cl |
| InChI | InChI=1S/C15H13Cl2N3O3/c1-10(21)18-15-12(16)7-11(8-13(15)17)20(23)14(22)9-19-5-3-2-4-6-19/h2-8,23H,9H2,1H3/p+1 |
| InChIKey | KEGGJYCDDHNFCJ-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 73.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|