4-acetamido-3,5-dichloro-2-hydroxybenzoic acid

C9H7Cl2NO4 — CID 172866613

IUPAC4-acetamido-3,5-dichloro-2-hydroxybenzoic acid
SMILESCC(=O)Nc1c(Cl)cc(C(=O)O)c(O)c1Cl
InChIInChI=1S/C9H7Cl2NO4/c1-3(13)12-7-5(10)2-4(9(15)16)8(14)6(7)11/h2,14H,1H3,(H,12,13)(H,15,16)
InChIKeyYUZCLQQORNLBJP-UHFFFAOYSA-N
MW264.06 g/mol
LogP2.36
Rot. Bonds2

About 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid

4-acetamido-3,5-dichloro-2-hydroxybenzoic acid (PubChem CID 172866613) has the molecular formula C9H7Cl2NO4 and a molecular weight of 264.06 g/mol. Its IUPAC name is 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid.

Molecular Properties

Compound Name4-acetamido-3,5-dichloro-2-hydroxybenzoic acid
PubChem CID172866613
Molecular FormulaC9H7Cl2NO4
Molecular Weight264.06 g/mol
Exact Mass262.98
IUPAC Name4-acetamido-3,5-dichloro-2-hydroxybenzoic acid
SMILESCC(=O)Nc1c(Cl)cc(C(=O)O)c(O)c1Cl
InChIInChI=1S/C9H7Cl2NO4/c1-3(13)12-7-5(10)2-4(9(15)16)8(14)6(7)11/h2,14H,1H3,(H,12,13)(H,15,16)
InChIKeyYUZCLQQORNLBJP-UHFFFAOYSA-N
XLogP2.36
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.06
LogP ≤ 52.36
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid?
The IUPAC name of 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid (CID 172866613) is 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid.
What is the SMILES notation for 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid?
The canonical SMILES for 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid is CC(=O)Nc1c(Cl)cc(C(=O)O)c(O)c1Cl.
What is the InChIKey of 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid?
The InChIKey is YUZCLQQORNLBJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2NO4/c1-3(13)12-7-5(10)2-4(9(15)16)8(14)6(7)11/h2,14H,1H3,(H,12,13)(H,15,16).
What are the key properties of 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid?
4-acetamido-3,5-dichloro-2-hydroxybenzoic acid has a molecular weight of 264.06 g/mol, XLogP of 2.36, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid is sourced from PubChem (CID 172866613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).