C9H7Cl2NO4 — CID 172866613
4-acetamido-3,5-dichloro-2-hydroxybenzoic acid (PubChem CID 172866613) has the molecular formula C9H7Cl2NO4 and a molecular weight of 264.06 g/mol. Its IUPAC name is 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid.
| Compound Name | 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 172866613 |
| Molecular Formula | C9H7Cl2NO4 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 4-acetamido-3,5-dichloro-2-hydroxybenzoic acid |
| SMILES | CC(=O)Nc1c(Cl)cc(C(=O)O)c(O)c1Cl |
| InChI | InChI=1S/C9H7Cl2NO4/c1-3(13)12-7-5(10)2-4(9(15)16)8(14)6(7)11/h2,14H,1H3,(H,12,13)(H,15,16) |
| InChIKey | YUZCLQQORNLBJP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |