C9H6Cl3NO4 — CID 86105784
3-acetamido-2,4,6-trichloro-5-hydroxybenzoic acid (PubChem CID 86105784) has the molecular formula C9H6Cl3NO4 and a molecular weight of 298.51 g/mol. Its IUPAC name is 3-acetamido-2,4,6-trichloro-5-hydroxybenzoic acid.
| Compound Name | 3-acetamido-2,4,6-trichloro-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 86105784 |
| Molecular Formula | C9H6Cl3NO4 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 296.94 |
| IUPAC Name | 3-acetamido-2,4,6-trichloro-5-hydroxybenzoic acid |
| SMILES | CC(=O)Nc1c(Cl)c(O)c(Cl)c(C(=O)O)c1Cl |
| InChI | InChI=1S/C9H6Cl3NO4/c1-2(14)13-7-4(10)3(9(16)17)5(11)8(15)6(7)12/h15H,1H3,(H,13,14)(H,16,17) |
| InChIKey | CTAZCBWIHRZNGF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |