C13H8Cl4N2O2 — CID 166984072
1-phenyl-3-(2,3,5,6-tetrachloro-4-hydroxyphenyl)urea (PubChem CID 166984072) has the molecular formula C13H8Cl4N2O2 and a molecular weight of 366.03 g/mol. Its IUPAC name is 1-phenyl-3-(2,3,5,6-tetrachloro-4-hydroxyphenyl)urea.
| Compound Name | 1-phenyl-3-(2,3,5,6-tetrachloro-4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 166984072 |
| Molecular Formula | C13H8Cl4N2O2 |
| Molecular Weight | 366.03 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | 1-phenyl-3-(2,3,5,6-tetrachloro-4-hydroxyphenyl)urea |
| SMILES | O=C(Nc1ccccc1)Nc1c(Cl)c(Cl)c(O)c(Cl)c1Cl |
| InChI | InChI=1S/C13H8Cl4N2O2/c14-7-9(16)12(20)10(17)8(15)11(7)19-13(21)18-6-4-2-1-3-5-6/h1-5,20H,(H2,18,19,21) |
| InChIKey | LYXPLEGDYYTLEC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.03 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|