C10H14N2O4 — CID 43551388
methyl N-(2-amino-4,5-dimethoxyphenyl)carbamate (PubChem CID 43551388) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl N-(2-amino-4,5-dimethoxyphenyl)carbamate.
| Compound Name | methyl N-(2-amino-4,5-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 43551388 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | methyl N-(2-amino-4,5-dimethoxyphenyl)carbamate |
| SMILES | COC(=O)Nc1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C10H14N2O4/c1-14-8-4-6(11)7(5-9(8)15-2)12-10(13)16-3/h4-5H,11H2,1-3H3,(H,12,13) |
| InChIKey | DPACJIVDTAASJA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|