C11H17N3O3 — CID 83001358
2-(2-amino-4,5-dimethoxyanilino)propanamide (PubChem CID 83001358) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-(2-amino-4,5-dimethoxyanilino)propanamide.
| Compound Name | 2-(2-amino-4,5-dimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 83001358 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-(2-amino-4,5-dimethoxyanilino)propanamide |
| SMILES | COc1cc(N)c(NC(C)C(N)=O)cc1OC |
| InChI | InChI=1S/C11H17N3O3/c1-6(11(13)15)14-8-5-10(17-3)9(16-2)4-7(8)12/h4-6,14H,12H2,1-3H3,(H2,13,15) |
| InChIKey | ZMENNWITSROHPI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|