C12H18FN3O2 — CID 106343926
2-(2-amino-4-fluoro-5-methoxyanilino)-3-methylbutanamide (PubChem CID 106343926) has the molecular formula C12H18FN3O2 and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-(2-amino-4-fluoro-5-methoxyanilino)-3-methylbutanamide.
| Compound Name | 2-(2-amino-4-fluoro-5-methoxyanilino)-3-methylbutanamide |
|---|---|
| PubChem CID | 106343926 |
| Molecular Formula | C12H18FN3O2 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-(2-amino-4-fluoro-5-methoxyanilino)-3-methylbutanamide |
| SMILES | COc1cc(NC(C(N)=O)C(C)C)c(N)cc1F |
| InChI | InChI=1S/C12H18FN3O2/c1-6(2)11(12(15)17)16-9-5-10(18-3)7(13)4-8(9)14/h4-6,11,16H,14H2,1-3H3,(H2,15,17) |
| InChIKey | BLQUUXPHZGDZDL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|