C12H19FN2O — CID 63597325
4-fluoro-5-methoxy-1-N-(2-methylbutyl)benzene-1,2-diamine (PubChem CID 63597325) has the molecular formula C12H19FN2O and a molecular weight of 226.29 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-1-N-(2-methylbutyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-methoxy-1-N-(2-methylbutyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63597325 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4-fluoro-5-methoxy-1-N-(2-methylbutyl)benzene-1,2-diamine |
| SMILES | CCC(C)CNc1cc(OC)c(F)cc1N |
| InChI | InChI=1S/C12H19FN2O/c1-4-8(2)7-15-11-6-12(16-3)9(13)5-10(11)14/h5-6,8,15H,4,7,14H2,1-3H3 |
| InChIKey | YZRQJCFTPRUADN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|