C14H23FN2O2 — CID 106251260
2-[(2-amino-4-fluoro-5-methoxyanilino)methyl]-2-ethylbutan-1-ol (PubChem CID 106251260) has the molecular formula C14H23FN2O2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-[(2-amino-4-fluoro-5-methoxyanilino)methyl]-2-ethylbutan-1-ol.
| Compound Name | 2-[(2-amino-4-fluoro-5-methoxyanilino)methyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 106251260 |
| Molecular Formula | C14H23FN2O2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-[(2-amino-4-fluoro-5-methoxyanilino)methyl]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)CNc1cc(OC)c(F)cc1N |
| InChI | InChI=1S/C14H23FN2O2/c1-4-14(5-2,9-18)8-17-12-7-13(19-3)10(15)6-11(12)16/h6-7,17-18H,4-5,8-9,16H2,1-3H3 |
| InChIKey | KIFXKGBVKKLQIN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|