C12H19FN2O2 — CID 104758804
4-fluoro-5-methoxy-1-N-(2-methoxy-2-methylpropyl)benzene-1,2-diamine (PubChem CID 104758804) has the molecular formula C12H19FN2O2 and a molecular weight of 242.29 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-1-N-(2-methoxy-2-methylpropyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-methoxy-1-N-(2-methoxy-2-methylpropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 104758804 |
| Molecular Formula | C12H19FN2O2 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-fluoro-5-methoxy-1-N-(2-methoxy-2-methylpropyl)benzene-1,2-diamine |
| SMILES | COc1cc(NCC(C)(C)OC)c(N)cc1F |
| InChI | InChI=1S/C12H19FN2O2/c1-12(2,17-4)7-15-10-6-11(16-3)8(13)5-9(10)14/h5-6,15H,7,14H2,1-4H3 |
| InChIKey | UZMXZIJAFXJXAC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|