C13H20FN3OS — CID 106324734
4-fluoro-5-methoxy-1-N-(2-thiomorpholin-4-ylethyl)benzene-1,2-diamine (PubChem CID 106324734) has the molecular formula C13H20FN3OS and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-1-N-(2-thiomorpholin-4-ylethyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-methoxy-1-N-(2-thiomorpholin-4-ylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106324734 |
| Molecular Formula | C13H20FN3OS |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-fluoro-5-methoxy-1-N-(2-thiomorpholin-4-ylethyl)benzene-1,2-diamine |
| SMILES | COc1cc(NCCN2CCSCC2)c(N)cc1F |
| InChI | InChI=1S/C13H20FN3OS/c1-18-13-9-12(11(15)8-10(13)14)16-2-3-17-4-6-19-7-5-17/h8-9,16H,2-7,15H2,1H3 |
| InChIKey | CHBNMMDONNIBJH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|