C11H17FN2O2 — CID 102694545
4-fluoro-5-methoxy-1-N-(2-methoxypropyl)benzene-1,2-diamine (PubChem CID 102694545) has the molecular formula C11H17FN2O2 and a molecular weight of 228.27 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-1-N-(2-methoxypropyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-methoxy-1-N-(2-methoxypropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 102694545 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 4-fluoro-5-methoxy-1-N-(2-methoxypropyl)benzene-1,2-diamine |
| SMILES | COc1cc(NCC(C)OC)c(N)cc1F |
| InChI | InChI=1S/C11H17FN2O2/c1-7(15-2)6-14-10-5-11(16-3)8(12)4-9(10)13/h4-5,7,14H,6,13H2,1-3H3 |
| InChIKey | CAVAFMMNGWECLC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|