C10H11BrClNO3 — CID 134113322
ethyl N-(5-bromo-4-chloro-2-methoxyphenyl)carbamate (PubChem CID 134113322) has the molecular formula C10H11BrClNO3 and a molecular weight of 308.56 g/mol. Its IUPAC name is ethyl N-(5-bromo-4-chloro-2-methoxyphenyl)carbamate.
| Compound Name | ethyl N-(5-bromo-4-chloro-2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 134113322 |
| Molecular Formula | C10H11BrClNO3 |
| Molecular Weight | 308.56 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | ethyl N-(5-bromo-4-chloro-2-methoxyphenyl)carbamate |
| SMILES | CCOC(=O)Nc1cc(Br)c(Cl)cc1OC |
| InChI | InChI=1S/C10H11BrClNO3/c1-3-16-10(14)13-8-4-6(11)7(12)5-9(8)15-2/h4-5H,3H2,1-2H3,(H,13,14) |
| InChIKey | QGYZYUSJMFDQQJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |