C10H16N2O — CID 146951235
2-methoxy-1-N,4-N,5-trimethylbenzene-1,4-diamine (PubChem CID 146951235) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-methoxy-1-N,4-N,5-trimethylbenzene-1,4-diamine.
| Compound Name | 2-methoxy-1-N,4-N,5-trimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 146951235 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-methoxy-1-N,4-N,5-trimethylbenzene-1,4-diamine |
| SMILES | CNc1cc(OC)c(NC)cc1C |
| InChI | InChI=1S/C10H16N2O/c1-7-5-9(12-3)10(13-4)6-8(7)11-2/h5-6,11-12H,1-4H3 |
| InChIKey | AITOUDJOKBZAAE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |