C17H18FN3O4 — CID 10545597
ethyl N-[N-[(4-fluorophenyl)carbamoyl]-4-methoxyanilino]carbamate (PubChem CID 10545597) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is ethyl N-[N-[(4-fluorophenyl)carbamoyl]-4-methoxyanilino]carbamate.
| Compound Name | ethyl N-[N-[(4-fluorophenyl)carbamoyl]-4-methoxyanilino]carbamate |
|---|---|
| PubChem CID | 10545597 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | ethyl N-[N-[(4-fluorophenyl)carbamoyl]-4-methoxyanilino]carbamate |
| SMILES | CCOC(=O)NN(C(=O)Nc1ccc(F)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H18FN3O4/c1-3-25-17(23)20-21(14-8-10-15(24-2)11-9-14)16(22)19-13-6-4-12(18)5-7-13/h4-11H,3H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | SDJPCFPGFKCDEF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|