C19H19BrFNO3 — CID 177164481
tert-butyl N-[4-bromo-2-fluoro-3-(2-methylbenzoyl)phenyl]carbamate (PubChem CID 177164481) has the molecular formula C19H19BrFNO3 and a molecular weight of 408.27 g/mol. Its IUPAC name is tert-butyl N-[4-bromo-2-fluoro-3-(2-methylbenzoyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-bromo-2-fluoro-3-(2-methylbenzoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 177164481 |
| Molecular Formula | C19H19BrFNO3 |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | tert-butyl N-[4-bromo-2-fluoro-3-(2-methylbenzoyl)phenyl]carbamate |
| SMILES | Cc1ccccc1C(=O)c1c(Br)ccc(NC(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C19H19BrFNO3/c1-11-7-5-6-8-12(11)17(23)15-13(20)9-10-14(16(15)21)22-18(24)25-19(2,3)4/h5-10H,1-4H3,(H,22,24) |
| InChIKey | LVUYNBAWSZYHDF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |