C17H16BrF2NO3 — CID 177164471
tert-butyl N-[4-bromo-2-fluoro-3-(2-fluorophenoxy)phenyl]carbamate (PubChem CID 177164471) has the molecular formula C17H16BrF2NO3 and a molecular weight of 400.22 g/mol. Its IUPAC name is tert-butyl N-[4-bromo-2-fluoro-3-(2-fluorophenoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-bromo-2-fluoro-3-(2-fluorophenoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 177164471 |
| Molecular Formula | C17H16BrF2NO3 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | tert-butyl N-[4-bromo-2-fluoro-3-(2-fluorophenoxy)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Br)c(Oc2ccccc2F)c1F |
| InChI | InChI=1S/C17H16BrF2NO3/c1-17(2,3)24-16(22)21-12-9-8-10(18)15(14(12)20)23-13-7-5-4-6-11(13)19/h4-9H,1-3H3,(H,21,22) |
| InChIKey | SCKWAVZBPGPMPW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |