C14H21FN2O4S — CID 162727302
tert-butyl N-[3-(dimethylsulfamoyl)-2-fluoro-4-methylphenyl]carbamate (PubChem CID 162727302) has the molecular formula C14H21FN2O4S and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl N-[3-(dimethylsulfamoyl)-2-fluoro-4-methylphenyl]carbamate.
| Compound Name | tert-butyl N-[3-(dimethylsulfamoyl)-2-fluoro-4-methylphenyl]carbamate |
|---|---|
| PubChem CID | 162727302 |
| Molecular Formula | C14H21FN2O4S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | tert-butyl N-[3-(dimethylsulfamoyl)-2-fluoro-4-methylphenyl]carbamate |
| SMILES | Cc1ccc(NC(=O)OC(C)(C)C)c(F)c1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C14H21FN2O4S/c1-9-7-8-10(16-13(18)21-14(2,3)4)11(15)12(9)22(19,20)17(5)6/h7-8H,1-6H3,(H,16,18) |
| InChIKey | CIEGGVACDIMNEU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |