C10H13FN2O3 — CID 118622100
tert-butyl N-(3-fluoro-2-oxo-1H-pyridin-4-yl)carbamate (PubChem CID 118622100) has the molecular formula C10H13FN2O3 and a molecular weight of 228.22 g/mol. Its IUPAC name is tert-butyl N-(3-fluoro-2-oxo-1H-pyridin-4-yl)carbamate.
| Compound Name | tert-butyl N-(3-fluoro-2-oxo-1H-pyridin-4-yl)carbamate |
|---|---|
| PubChem CID | 118622100 |
| Molecular Formula | C10H13FN2O3 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | tert-butyl N-(3-fluoro-2-oxo-1H-pyridin-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc[nH]c(=O)c1F |
| InChI | InChI=1S/C10H13FN2O3/c1-10(2,3)16-9(15)13-6-4-5-12-8(14)7(6)11/h4-5H,1-3H3,(H2,12,13,14,15) |
| InChIKey | ACPCCUGDJUHYCS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |