C10H13ClN2O3 — CID 138675843
tert-butyl N-(5-chloro-2-oxo-1H-pyridin-3-yl)carbamate (PubChem CID 138675843) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-2-oxo-1H-pyridin-3-yl)carbamate.
| Compound Name | tert-butyl N-(5-chloro-2-oxo-1H-pyridin-3-yl)carbamate |
|---|---|
| PubChem CID | 138675843 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | tert-butyl N-(5-chloro-2-oxo-1H-pyridin-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cl)c[nH]c1=O |
| InChI | InChI=1S/C10H13ClN2O3/c1-10(2,3)16-9(15)13-7-4-6(11)5-12-8(7)14/h4-5H,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | PHXMPXBXAZEAMK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |