C13H19NO2 — CID 12009520
5,6-dimethoxy-N,N-dimethyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 12009520) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 5,6-dimethoxy-N,N-dimethyl-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5,6-dimethoxy-N,N-dimethyl-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 12009520 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 5,6-dimethoxy-N,N-dimethyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | COc1cc2c(cc1OC)CC(N(C)C)C2 |
| InChI | InChI=1S/C13H19NO2/c1-14(2)11-5-9-7-12(15-3)13(16-4)8-10(9)6-11/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | DYQUYWLIGRBNGV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |