C14H22N2O2 — CID 83002643
7,8-dimethoxy-3-propyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine (PubChem CID 83002643) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 7,8-dimethoxy-3-propyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine.
| Compound Name | 7,8-dimethoxy-3-propyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 83002643 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 7,8-dimethoxy-3-propyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
| SMILES | CCCC1CNc2cc(OC)c(OC)cc2NC1 |
| InChI | InChI=1S/C14H22N2O2/c1-4-5-10-8-15-11-6-13(17-2)14(18-3)7-12(11)16-9-10/h6-7,10,15-16H,4-5,8-9H2,1-3H3 |
| InChIKey | NYFSBBOZRAKTAQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|