C13H20N2O2 — CID 83008630
6,7-dimethoxy-2-propan-2-yl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 83008630) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 6,7-dimethoxy-2-propan-2-yl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 6,7-dimethoxy-2-propan-2-yl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 83008630 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 6,7-dimethoxy-2-propan-2-yl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | COc1cc2c(cc1OC)NC(C(C)C)CN2 |
| InChI | InChI=1S/C13H20N2O2/c1-8(2)11-7-14-9-5-12(16-3)13(17-4)6-10(9)15-11/h5-6,8,11,14-15H,7H2,1-4H3 |
| InChIKey | WADNNEUDEQHSPL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|