C18H25NO5 — CID 170491319
tert-butyl N-[4-(2-formyl-4,5-dimethoxyphenyl)but-3-enyl]carbamate (PubChem CID 170491319) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl N-[4-(2-formyl-4,5-dimethoxyphenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-formyl-4,5-dimethoxyphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170491319 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | tert-butyl N-[4-(2-formyl-4,5-dimethoxyphenyl)but-3-enyl]carbamate |
| SMILES | COc1cc(C=O)c(C=CCCNC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C18H25NO5/c1-18(2,3)24-17(21)19-9-7-6-8-13-10-15(22-4)16(23-5)11-14(13)12-20/h6,8,10-12H,7,9H2,1-5H3,(H,19,21) |
| InChIKey | TYDSWIMXPROXTC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|