C10H13ClN2O3 — CID 67316649
(2S)-5-methoxy-2-methyl-6-nitro-2,3-dihydro-1H-indole;hydrochloride (PubChem CID 67316649) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is (2S)-5-methoxy-2-methyl-6-nitro-2,3-dihydro-1H-indole;hydrochloride.
| Compound Name | (2S)-5-methoxy-2-methyl-6-nitro-2,3-dihydro-1H-indole;hydrochloride |
|---|---|
| PubChem CID | 67316649 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | (2S)-5-methoxy-2-methyl-6-nitro-2,3-dihydro-1H-indole;hydrochloride |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])N[C@@H](C)C2.Cl |
| InChI | InChI=1S/C10H12N2O3.ClH/c1-6-3-7-4-10(15-2)9(12(13)14)5-8(7)11-6;/h4-6,11H,3H2,1-2H3;1H/t6-;/m0./s1 |
| InChIKey | HJSNILXSJOLOLD-RGMNGODLSA-N |
| XLogP | 2.38 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|