C11H14N2O4 — CID 177239539
5-methoxy-1-(methoxymethyl)-6-nitro-2,3-dihydro-1H-isoindole (PubChem CID 177239539) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 5-methoxy-1-(methoxymethyl)-6-nitro-2,3-dihydro-1H-isoindole.
| Compound Name | 5-methoxy-1-(methoxymethyl)-6-nitro-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 177239539 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 5-methoxy-1-(methoxymethyl)-6-nitro-2,3-dihydro-1H-isoindole |
| SMILES | COCC1NCc2cc(OC)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C11H14N2O4/c1-16-6-9-8-4-10(13(14)15)11(17-2)3-7(8)5-12-9/h3-4,9,12H,5-6H2,1-2H3 |
| InChIKey | NHTWQHXJQXHRSC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|