C10H12N2O3S — CID 1204071
(2R)-2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine (PubChem CID 1204071) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is (2R)-2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine.
| Compound Name | (2R)-2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 1204071 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (2R)-2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine |
| SMILES | COc1ccc([C@@H]2NCCS2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N2O3S/c1-15-9-3-2-7(6-8(9)12(13)14)10-11-4-5-16-10/h2-3,6,10-11H,4-5H2,1H3/t10-/m1/s1 |
| InChIKey | HLCWNEAISJRAQI-SNVBAGLBSA-N |
| XLogP | 1.94 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|