C11H15NO2S — CID 3050896
2-(3,4-dimethoxyphenyl)-1,3-thiazolidine (PubChem CID 3050896) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,3-thiazolidine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 3050896 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazolidine |
| SMILES | COc1ccc(C2NCCS2)cc1OC |
| InChI | InChI=1S/C11H15NO2S/c1-13-9-4-3-8(7-10(9)14-2)11-12-5-6-15-11/h3-4,7,11-12H,5-6H2,1-2H3 |
| InChIKey | SEBSCXLWNCIHNW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |