C10H12BrNO2S — CID 97288722
2-bromo-6-methoxy-4-[(2R)-1,3-thiazolidin-2-yl]phenol (PubChem CID 97288722) has the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(2R)-1,3-thiazolidin-2-yl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(2R)-1,3-thiazolidin-2-yl]phenol |
|---|---|
| PubChem CID | 97288722 |
| Molecular Formula | C10H12BrNO2S |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(2R)-1,3-thiazolidin-2-yl]phenol |
| SMILES | COc1cc([C@@H]2NCCS2)cc(Br)c1O |
| InChI | InChI=1S/C10H12BrNO2S/c1-14-8-5-6(4-7(11)9(8)13)10-12-2-3-15-10/h4-5,10,12-13H,2-3H2,1H3/t10-/m1/s1 |
| InChIKey | XHSIPPTUGCKMOS-SNVBAGLBSA-N |
| XLogP | 2.50 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |