C11H16ClNO3 — CID 171197135
4-[(2R)-azetidin-2-yl]-2,6-dimethoxyphenol;hydrochloride (PubChem CID 171197135) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 4-[(2R)-azetidin-2-yl]-2,6-dimethoxyphenol;hydrochloride.
| Compound Name | 4-[(2R)-azetidin-2-yl]-2,6-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171197135 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-[(2R)-azetidin-2-yl]-2,6-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc([C@H]2CCN2)cc(OC)c1O.Cl |
| InChI | InChI=1S/C11H15NO3.ClH/c1-14-9-5-7(8-3-4-12-8)6-10(15-2)11(9)13;/h5-6,8,12-13H,3-4H2,1-2H3;1H/t8-;/m1./s1 |
| InChIKey | DWWKFTIVQPTECG-DDWIOCJRSA-N |
| XLogP | 1.87 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |